About ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate
ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate (PubChem CID 66817607) has the molecular formula C12H17F3O2
and a molecular weight of 250.26 g/mol. Its IUPAC name is ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate |
| PubChem CID | 66817607 |
| Molecular Formula | C12H17F3O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(=CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H17F3O2/c1-2-17-11(16)10-5-3-9(4-6-10)7-8-12(13,14)15/h7,10H,2-6,8H2,1H3/b9-7- |
| InChIKey | VHDYZPHDWVYQMT-CLFYSBASSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate (CID 66817607) is ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate is CCOC(=O)C1CCC(=CCC(F)(F)F)CC1.
What is the InChIKey of ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate?
The InChIKey is VHDYZPHDWVYQMT-CLFYSBASSA-N. The full InChI is InChI=1S/C12H17F3O2/c1-2-17-11(16)10-5-3-9(4-6-10)7-8-12(13,14)15/h7,10H,2-6,8H2,1H3/b9-7-.
What are the key properties of ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate?
ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate has a molecular weight of 250.26 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3,3,3-trifluoropropylidene)cyclohexane-1-carboxylate is sourced from PubChem (CID 66817607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).