C30H46N4O5S — CID 66818196
8-[2-[4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-2-methylphenyl]ethylsulfonyl]-2-nonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66818196) has the molecular formula C30H46N4O5S and a molecular weight of 574.79 g/mol. Its IUPAC name is 8-[2-[4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-2-methylphenyl]ethylsulfonyl]-2-nonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-2-methylphenyl]ethylsulfonyl]-2-nonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66818196 |
| Molecular Formula | C30H46N4O5S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 8-[2-[4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-2-methylphenyl]ethylsulfonyl]-2-nonyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CCCCCCCCCC1=NC2(CCN(S(=O)(=O)CCc3ccc(C(=O)N4CC[C@@H](O)C4)cc3C)CC2)C(=O)N1 |
| InChI | InChI=1S/C30H46N4O5S/c1-3-4-5-6-7-8-9-10-27-31-29(37)30(32-27)15-18-34(19-16-30)40(38,39)20-14-24-11-12-25(21-23(24)2)28(36)33-17-13-26(35)22-33/h11-12,21,26,35H,3-10,13-20,22H2,1-2H3,(H,31,32,37)/t26-/m1/s1 |
| InChIKey | YJQZASWWWZHHKG-AREMUKBSSA-N |
| XLogP | 3.58 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|