C13H21N — CID 66818339
7-(cyclohepten-1-yl)-2,3,4,5-tetrahydro-1H-azepine (PubChem CID 66818339) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 7-(cyclohepten-1-yl)-2,3,4,5-tetrahydro-1H-azepine.
| Compound Name | 7-(cyclohepten-1-yl)-2,3,4,5-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 66818339 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 7-(cyclohepten-1-yl)-2,3,4,5-tetrahydro-1H-azepine |
| SMILES | C1=C(C2=CCCCCN2)CCCCC1 |
| InChI | InChI=1S/C13H21N/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-14-13/h8,10,14H,1-7,9,11H2 |
| InChIKey | GAEOYQLSLWPKQR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |