C36H41N3O8 — CID 6681906
benzyl N-[1-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6681906) has the molecular formula C36H41N3O8 and a molecular weight of 643.74 g/mol. Its IUPAC name is benzyl N-[1-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6681906 |
| Molecular Formula | C36H41N3O8 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | benzyl N-[1-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(morpholin-4-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(CN3C(=O)CC(NC(=O)OCc4ccccc4)C3=O)cc2)O[C@@H]1CN1CCOCC1 |
| InChI | InChI=1S/C36H41N3O8/c1-24-31(21-38-15-17-44-18-16-38)46-35(47-33(24)28-11-9-26(22-40)10-12-28)29-13-7-25(8-14-29)20-39-32(41)19-30(34(39)42)37-36(43)45-23-27-5-3-2-4-6-27/h2-14,24,30-31,33,35,40H,15-23H2,1H3,(H,37,43)/t24-,30?,31+,33?,35+/m0/s1 |
| InChIKey | TXVDAKTWBGBJBF-MSYSLAGNSA-N |
| XLogP | 3.86 |
| TPSA | 126.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|