About 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine
6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine (PubChem CID 66819162) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine.
Analyze 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
The IUPAC name of 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine (CID 66819162) is 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine.
What is the SMILES notation for 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
The canonical SMILES for 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine is Cc1ccc2c(n1)OCCN2.
What is the InChIKey of 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
The InChIKey is CCTPHLYUFGNYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-6-2-3-7-8(10-6)11-5-4-9-7/h2-3,9H,4-5H2,1H3.
What are the key properties of 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine has a molecular weight of 150.18 g/mol, XLogP of 1.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine is sourced from PubChem (CID 66819162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).