About 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine
3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine (PubChem CID 66819594) has the molecular formula C26H29N3
and a molecular weight of 383.54 g/mol. Its IUPAC name is 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine |
| PubChem CID | 66819594 |
| Molecular Formula | C26H29N3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine |
| SMILES | Nc1cccc(C2C[C@H]3CC[C@@H](C2)N3C(c2ccccc2)c2ccccc2)c1N |
| InChI | InChI=1S/C26H29N3/c27-24-13-7-12-23(25(24)28)20-16-21-14-15-22(17-20)29(21)26(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-13,20-22,26H,14-17,27-28H2/t20?,21-,22+ |
| InChIKey | QOHORVKUBJOVIC-FRIKZZABSA-N |
| XLogP | 5.35 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine?
The IUPAC name of 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine (CID 66819594) is 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine.
What is the SMILES notation for 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine?
The canonical SMILES for 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine is Nc1cccc(C2C[C@H]3CC[C@@H](C2)N3C(c2ccccc2)c2ccccc2)c1N.
What is the InChIKey of 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine?
The InChIKey is QOHORVKUBJOVIC-FRIKZZABSA-N. The full InChI is InChI=1S/C26H29N3/c27-24-13-7-12-23(25(24)28)20-16-21-14-15-22(17-20)29(21)26(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-13,20-22,26H,14-17,27-28H2/t20?,21-,22+.
What are the key properties of 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine?
3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine has a molecular weight of 383.54 g/mol, XLogP of 5.35, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,5S)-8-benzhydryl-8-azabicyclo[3.2.1]octan-3-yl]benzene-1,2-diamine is sourced from PubChem (CID 66819594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).