About 4-pentyl-1H-pyrimidine-2,4-diamine
4-pentyl-1H-pyrimidine-2,4-diamine (PubChem CID 66819834) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 4-pentyl-1H-pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-pentyl-1H-pyrimidine-2,4-diamine |
| PubChem CID | 66819834 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 4-pentyl-1H-pyrimidine-2,4-diamine |
| SMILES | CCCCCC1(N)C=CNC(N)=N1 |
| InChI | InChI=1S/C9H18N4/c1-2-3-4-5-9(11)6-7-12-8(10)13-9/h6-7H,2-5,11H2,1H3,(H3,10,12,13) |
| InChIKey | JRJCNSHUVWOZQH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentyl-1H-pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentyl-1H-pyrimidine-2,4-diamine?
The IUPAC name of 4-pentyl-1H-pyrimidine-2,4-diamine (CID 66819834) is 4-pentyl-1H-pyrimidine-2,4-diamine.
What is the SMILES notation for 4-pentyl-1H-pyrimidine-2,4-diamine?
The canonical SMILES for 4-pentyl-1H-pyrimidine-2,4-diamine is CCCCCC1(N)C=CNC(N)=N1.
What is the InChIKey of 4-pentyl-1H-pyrimidine-2,4-diamine?
The InChIKey is JRJCNSHUVWOZQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-2-3-4-5-9(11)6-7-12-8(10)13-9/h6-7H,2-5,11H2,1H3,(H3,10,12,13).
What are the key properties of 4-pentyl-1H-pyrimidine-2,4-diamine?
4-pentyl-1H-pyrimidine-2,4-diamine has a molecular weight of 182.27 g/mol, XLogP of 0.65, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentyl-1H-pyrimidine-2,4-diamine is sourced from PubChem (CID 66819834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).