C19H27F2N3O2 — CID 66820034
(1S,4R)-3-N-[4-(3,3-difluoropyrrolidin-1-yl)butyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 66820034) has the molecular formula C19H27F2N3O2 and a molecular weight of 367.44 g/mol. Its IUPAC name is (1S,4R)-3-N-[4-(3,3-difluoropyrrolidin-1-yl)butyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,4R)-3-N-[4-(3,3-difluoropyrrolidin-1-yl)butyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 66820034 |
| Molecular Formula | C19H27F2N3O2 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (1S,4R)-3-N-[4-(3,3-difluoropyrrolidin-1-yl)butyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | NC(=O)C1C(C(=O)NCCCCN2CCC(F)(F)C2)[C@H]2C=C[C@@H]1C21CC1 |
| InChI | InChI=1S/C19H27F2N3O2/c20-19(21)7-10-24(11-19)9-2-1-8-23-17(26)15-13-4-3-12(14(15)16(22)25)18(13)5-6-18/h3-4,12-15H,1-2,5-11H2,(H2,22,25)(H,23,26)/t12-,13+,14?,15?/m0/s1 |
| InChIKey | FJONPMBZFQVVFA-ZUJMUWTESA-N |
| XLogP | 1.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|