About [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine
[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine (PubChem CID 66820044) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine |
| PubChem CID | 66820044 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine |
| SMILES | CC1(c2cnc(CN)s2)OCCO1 |
| InChI | InChI=1S/C8H12N2O2S/c1-8(11-2-3-12-8)6-5-10-7(4-9)13-6/h5H,2-4,9H2,1H3 |
| InChIKey | OBHXKIZZZONVPC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine?
The IUPAC name of [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine (CID 66820044) is [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine.
What is the SMILES notation for [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine?
The canonical SMILES for [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine is CC1(c2cnc(CN)s2)OCCO1.
What is the InChIKey of [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine?
The InChIKey is OBHXKIZZZONVPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-8(11-2-3-12-8)6-5-10-7(4-9)13-6/h5H,2-4,9H2,1H3.
What are the key properties of [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine?
[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine has a molecular weight of 200.26 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanamine is sourced from PubChem (CID 66820044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).