C17H14BrF2NO3 — CID 66820056
(1R,2R,4S)-3-[(4-bromo-2,3-difluorophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxylic acid (PubChem CID 66820056) has the molecular formula C17H14BrF2NO3 and a molecular weight of 398.20 g/mol. Its IUPAC name is (1R,2R,4S)-3-[(4-bromo-2,3-difluorophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxylic acid.
| Compound Name | (1R,2R,4S)-3-[(4-bromo-2,3-difluorophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxylic acid |
|---|---|
| PubChem CID | 66820056 |
| Molecular Formula | C17H14BrF2NO3 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | (1R,2R,4S)-3-[(4-bromo-2,3-difluorophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxylic acid |
| SMILES | O=C(Nc1ccc(Br)c(F)c1F)C1[C@H](C(=O)O)[C@H]2C=C[C@@H]1C21CC1 |
| InChI | InChI=1S/C17H14BrF2NO3/c18-9-3-4-10(14(20)13(9)19)21-15(22)11-7-1-2-8(12(11)16(23)24)17(7)5-6-17/h1-4,7-8,11-12H,5-6H2,(H,21,22)(H,23,24)/t7-,8+,11?,12+/m0/s1 |
| InChIKey | PHQIHWBQBQLTSH-XUJVNZCYSA-N |
| XLogP | 3.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|