C15H24BrN5O6S2 — CID 66820098
2-amino-5-bromo-3-[4-[(2-methylpropan-2-yl)oxycarbonyl-(sulfinoamino)amino]piperidin-1-yl]sulfonylpyridine (PubChem CID 66820098) has the molecular formula C15H24BrN5O6S2 and a molecular weight of 514.42 g/mol. Its IUPAC name is 2-amino-5-bromo-3-[4-[(2-methylpropan-2-yl)oxycarbonyl-(sulfinoamino)amino]piperidin-1-yl]sulfonylpyridine.
| Compound Name | 2-amino-5-bromo-3-[4-[(2-methylpropan-2-yl)oxycarbonyl-(sulfinoamino)amino]piperidin-1-yl]sulfonylpyridine |
|---|---|
| PubChem CID | 66820098 |
| Molecular Formula | C15H24BrN5O6S2 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 2-amino-5-bromo-3-[4-[(2-methylpropan-2-yl)oxycarbonyl-(sulfinoamino)amino]piperidin-1-yl]sulfonylpyridine |
| SMILES | CC(C)(C)OC(=O)N(NS(=O)O)C1CCN(S(=O)(=O)c2cc(Br)cnc2N)CC1 |
| InChI | InChI=1S/C15H24BrN5O6S2/c1-15(2,3)27-14(22)21(19-28(23)24)11-4-6-20(7-5-11)29(25,26)12-8-10(16)9-18-13(12)17/h8-9,11,19H,4-7H2,1-3H3,(H2,17,18)(H,23,24) |
| InChIKey | WKIVDWAVIDLJFN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|