C26H31BrFN7OSSi — CID 66820631
4-bromo-2-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]thiophene-3-carbonitrile (PubChem CID 66820631) has the molecular formula C26H31BrFN7OSSi and a molecular weight of 616.64 g/mol. Its IUPAC name is 4-bromo-2-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]thiophene-3-carbonitrile.
| Compound Name | 4-bromo-2-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 66820631 |
| Molecular Formula | C26H31BrFN7OSSi |
| Molecular Weight | 616.64 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | 4-bromo-2-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]thiophene-3-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CF)[C@H]4CCN(c5scc(Br)c5C#N)C4)c3)ncnc21 |
| InChI | InChI=1S/C26H31BrFN7OSSi/c1-38(2,3)9-8-36-17-34-7-5-20-24(30-16-31-25(20)34)19-12-32-35(14-19)23(10-28)18-4-6-33(13-18)26-21(11-29)22(27)15-37-26/h5,7,12,14-16,18,23H,4,6,8-10,13,17H2,1-3H3/t18-,23?/m0/s1 |
| InChIKey | RAVOUAAHARKJDQ-XNUZUHMRSA-N |
| XLogP | 6.34 |
| TPSA | 84.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|