C27H38FN7O3Si — CID 66820759
tert-butyl 3-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]-3-fluoropyrrolidine-1-carboxylate (PubChem CID 66820759) has the molecular formula C27H38FN7O3Si and a molecular weight of 555.73 g/mol. Its IUPAC name is tert-butyl 3-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]-3-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]-3-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66820759 |
| Molecular Formula | C27H38FN7O3Si |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | tert-butyl 3-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]-3-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(C(CC#N)n2cc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)cn2)C1 |
| InChI | InChI=1S/C27H38FN7O3Si/c1-26(2,3)38-25(36)33-12-9-27(28,17-33)22(7-10-29)35-16-20(15-32-35)23-21-8-11-34(24(21)31-18-30-23)19-37-13-14-39(4,5)6/h8,11,15-16,18,22H,7,9,12-14,17,19H2,1-6H3 |
| InChIKey | ZFLKYRCIJMDUCT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 111.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|