C25H31FN8OSSi — CID 66820854
5-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]-1,3-thiazole-4-carbonitrile (PubChem CID 66820854) has the molecular formula C25H31FN8OSSi and a molecular weight of 538.73 g/mol. Its IUPAC name is 5-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]-1,3-thiazole-4-carbonitrile.
| Compound Name | 5-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 66820854 |
| Molecular Formula | C25H31FN8OSSi |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 5-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]-1,3-thiazole-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CF)[C@H]4CCN(c5scnc5C#N)C4)c3)ncnc21 |
| InChI | InChI=1S/C25H31FN8OSSi/c1-37(2,3)9-8-35-17-33-7-5-20-23(28-15-29-24(20)33)19-12-31-34(14-19)22(10-26)18-4-6-32(13-18)25-21(11-27)30-16-36-25/h5,7,12,14-16,18,22H,4,6,8-10,13,17H2,1-3H3/t18-,22?/m0/s1 |
| InChIKey | RVCMRFSOBHQXLL-HXBUSHRASA-N |
| XLogP | 4.97 |
| TPSA | 97.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|