C26H32FN7OSSi — CID 66820856
5-[3-[2-fluoro-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidin-1-yl]-1,3-thiazole-4-carbonitrile (PubChem CID 66820856) has the molecular formula C26H32FN7OSSi and a molecular weight of 537.74 g/mol. Its IUPAC name is 5-[3-[2-fluoro-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidin-1-yl]-1,3-thiazole-4-carbonitrile.
| Compound Name | 5-[3-[2-fluoro-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidin-1-yl]-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 66820856 |
| Molecular Formula | C26H32FN7OSSi |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 5-[3-[2-fluoro-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidin-1-yl]-1,3-thiazole-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3ccn(C(CF)C4CCN(c5scnc5C#N)C4)c3)ncnc21 |
| InChI | InChI=1S/C26H32FN7OSSi/c1-37(2,3)11-10-35-18-34-9-6-21-24(29-16-30-25(21)34)20-5-7-32(15-20)23(12-27)19-4-8-33(14-19)26-22(13-28)31-17-36-26/h5-7,9,15-17,19,23H,4,8,10-12,14,18H2,1-3H3 |
| InChIKey | MGKWTQAKSBFTBD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 84.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|