C28H32ClN9OSi — CID 66820949
3-chloro-2-[3-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]pyridine-4-carbonitrile (PubChem CID 66820949) has the molecular formula C28H32ClN9OSi and a molecular weight of 574.17 g/mol. Its IUPAC name is 3-chloro-2-[3-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]pyridine-4-carbonitrile.
| Compound Name | 3-chloro-2-[3-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 66820949 |
| Molecular Formula | C28H32ClN9OSi |
| Molecular Weight | 574.17 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 3-chloro-2-[3-[2-cyano-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]pyridine-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC#N)C4CCN(c5nccc(C#N)c5Cl)C4)c3)ncnc21 |
| InChI | InChI=1S/C28H32ClN9OSi/c1-40(2,3)13-12-39-19-37-11-7-23-26(33-18-34-27(23)37)22-15-35-38(17-22)24(4-8-30)21-6-10-36(16-21)28-25(29)20(14-31)5-9-32-28/h5,7,9,11,15,17-18,21,24H,4,6,10,12-13,16,19H2,1-3H3 |
| InChIKey | IEYYUGLTTCYCGV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 121.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.17 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|