C22H26N2O2 — CID 66820987
(3aR,10bS)-8-[3-(2-hydroxyethyl)phenyl]-2,5-dimethyl-3,3a,4,10b-tetrahydro-1H-pyrrolo[3,4-d][2]benzazepin-6-one (PubChem CID 66820987) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3aR,10bS)-8-[3-(2-hydroxyethyl)phenyl]-2,5-dimethyl-3,3a,4,10b-tetrahydro-1H-pyrrolo[3,4-d][2]benzazepin-6-one.
| Compound Name | (3aR,10bS)-8-[3-(2-hydroxyethyl)phenyl]-2,5-dimethyl-3,3a,4,10b-tetrahydro-1H-pyrrolo[3,4-d][2]benzazepin-6-one |
|---|---|
| PubChem CID | 66820987 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (3aR,10bS)-8-[3-(2-hydroxyethyl)phenyl]-2,5-dimethyl-3,3a,4,10b-tetrahydro-1H-pyrrolo[3,4-d][2]benzazepin-6-one |
| SMILES | CN1C[C@@H]2CN(C)C(=O)c3cc(-c4cccc(CCO)c4)ccc3[C@H]2C1 |
| InChI | InChI=1S/C22H26N2O2/c1-23-12-18-13-24(2)22(26)20-11-17(6-7-19(20)21(18)14-23)16-5-3-4-15(10-16)8-9-25/h3-7,10-11,18,21,25H,8-9,12-14H2,1-2H3/t18-,21+/m1/s1 |
| InChIKey | WMKWKFOBWOQDIM-NQIIRXRSSA-N |
| XLogP | 2.62 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |