C29H33FN8OSi — CID 66820990
3-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]benzene-1,2-dicarbonitrile (PubChem CID 66820990) has the molecular formula C29H33FN8OSi and a molecular weight of 556.72 g/mol. Its IUPAC name is 3-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 66820990 |
| Molecular Formula | C29H33FN8OSi |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 3-[(3S)-3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]benzene-1,2-dicarbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CF)[C@H]4CCN(c5cccc(C#N)c5C#N)C4)c3)ncnc21 |
| InChI | InChI=1S/C29H33FN8OSi/c1-40(2,3)12-11-39-20-37-10-8-24-28(33-19-34-29(24)37)23-16-35-38(18-23)27(13-30)22-7-9-36(17-22)26-6-4-5-21(14-31)25(26)15-32/h4-6,8,10,16,18-19,22,27H,7,9,11-13,17,20H2,1-3H3/t22-,27?/m0/s1 |
| InChIKey | GFBSWZHPBLZUFI-YMQLSTQVSA-N |
| XLogP | 5.39 |
| TPSA | 108.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|