C13H15FN2O — CID 66821054
(3aS,10bS)-9-fluoro-2-methyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one (PubChem CID 66821054) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is (3aS,10bS)-9-fluoro-2-methyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one.
| Compound Name | (3aS,10bS)-9-fluoro-2-methyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
|---|---|
| PubChem CID | 66821054 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (3aS,10bS)-9-fluoro-2-methyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
| SMILES | CN1C[C@@H]2CNC(=O)c3ccc(F)cc3[C@H]2C1 |
| InChI | InChI=1S/C13H15FN2O/c1-16-6-8-5-15-13(17)10-3-2-9(14)4-11(10)12(8)7-16/h2-4,8,12H,5-7H2,1H3,(H,15,17)/t8-,12-/m0/s1 |
| InChIKey | VWNGHLXZACVIFC-UFBFGSQYSA-N |
| XLogP | 1.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |