C27H33FN8O2Si — CID 66821070
2-[[4-[1-[2-fluoro-1-[(3S)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)pyrrolidin-3-yl]ethyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 66821070) has the molecular formula C27H33FN8O2Si and a molecular weight of 548.70 g/mol. Its IUPAC name is 2-[[4-[1-[2-fluoro-1-[(3S)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)pyrrolidin-3-yl]ethyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[1-[2-fluoro-1-[(3S)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)pyrrolidin-3-yl]ethyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 66821070 |
| Molecular Formula | C27H33FN8O2Si |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 2-[[4-[1-[2-fluoro-1-[(3S)-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)pyrrolidin-3-yl]ethyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CF)[C@H]4CCN(c5nc6cccnc6o5)C4)c3)ncnc21 |
| InChI | InChI=1S/C27H33FN8O2Si/c1-39(2,3)12-11-37-18-35-10-7-21-24(30-17-31-25(21)35)20-14-32-36(16-20)23(13-28)19-6-9-34(15-19)27-33-22-5-4-8-29-26(22)38-27/h4-5,7-8,10,14,16-17,19,23H,6,9,11-13,15,18H2,1-3H3/t19-,23?/m0/s1 |
| InChIKey | ZBFMAAGENAYCME-HSTJUUNISA-N |
| XLogP | 5.18 |
| TPSA | 99.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|