C27H40FN5O3Si — CID 66821078
tert-butyl 3-[2-fluoro-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidine-1-carboxylate (PubChem CID 66821078) has the molecular formula C27H40FN5O3Si and a molecular weight of 529.73 g/mol. Its IUPAC name is tert-butyl 3-[2-fluoro-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-fluoro-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66821078 |
| Molecular Formula | C27H40FN5O3Si |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | tert-butyl 3-[2-fluoro-1-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrol-1-yl]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(CF)n2ccc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)c2)C1 |
| InChI | InChI=1S/C27H40FN5O3Si/c1-27(2,3)36-26(34)32-11-7-20(16-32)23(15-28)31-10-8-21(17-31)24-22-9-12-33(25(22)30-18-29-24)19-35-13-14-37(4,5)6/h8-10,12,17-18,20,23H,7,11,13-16,19H2,1-6H3 |
| InChIKey | WQOCRDLXCAWILP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|