C20H28FN7O — CID 66822183
4-[1-[7-fluoro-2-(3-methoxypropylamino)-8-methylquinolin-3-yl]ethyl]-4-methyl-1H-1,3,5-triazine-2,6-diamine (PubChem CID 66822183) has the molecular formula C20H28FN7O and a molecular weight of 401.49 g/mol. Its IUPAC name is 4-[1-[7-fluoro-2-(3-methoxypropylamino)-8-methylquinolin-3-yl]ethyl]-4-methyl-1H-1,3,5-triazine-2,6-diamine.
| Compound Name | 4-[1-[7-fluoro-2-(3-methoxypropylamino)-8-methylquinolin-3-yl]ethyl]-4-methyl-1H-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 66822183 |
| Molecular Formula | C20H28FN7O |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 4-[1-[7-fluoro-2-(3-methoxypropylamino)-8-methylquinolin-3-yl]ethyl]-4-methyl-1H-1,3,5-triazine-2,6-diamine |
| SMILES | COCCCNc1nc2c(C)c(F)ccc2cc1C(C)C1(C)N=C(N)NC(N)=N1 |
| InChI | InChI=1S/C20H28FN7O/c1-11-15(21)7-6-13-10-14(17(25-16(11)13)24-8-5-9-29-4)12(2)20(3)27-18(22)26-19(23)28-20/h6-7,10,12H,5,8-9H2,1-4H3,(H,24,25)(H5,22,23,26,27,28) |
| InChIKey | FBXRTBHUAKYIHL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|