C19H26FN7O — CID 66822205
4-[1-[7-fluoro-2-(2-methoxyethylamino)-8-methylquinolin-3-yl]ethyl]-4-methyl-1H-1,3,5-triazine-2,6-diamine (PubChem CID 66822205) has the molecular formula C19H26FN7O and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-[1-[7-fluoro-2-(2-methoxyethylamino)-8-methylquinolin-3-yl]ethyl]-4-methyl-1H-1,3,5-triazine-2,6-diamine.
| Compound Name | 4-[1-[7-fluoro-2-(2-methoxyethylamino)-8-methylquinolin-3-yl]ethyl]-4-methyl-1H-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 66822205 |
| Molecular Formula | C19H26FN7O |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-[1-[7-fluoro-2-(2-methoxyethylamino)-8-methylquinolin-3-yl]ethyl]-4-methyl-1H-1,3,5-triazine-2,6-diamine |
| SMILES | COCCNc1nc2c(C)c(F)ccc2cc1C(C)C1(C)N=C(N)NC(N)=N1 |
| InChI | InChI=1S/C19H26FN7O/c1-10-14(20)6-5-12-9-13(16(24-15(10)12)23-7-8-28-4)11(2)19(3)26-17(21)25-18(22)27-19/h5-6,9,11H,7-8H2,1-4H3,(H,23,24)(H5,21,22,25,26,27) |
| InChIKey | FDYJFMHILIPMTC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|