C29H35N5O4Si — CID 66822570
8-[(3aS,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 66822570) has the molecular formula C29H35N5O4Si and a molecular weight of 545.72 g/mol. Its IUPAC name is 8-[(3aS,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-[(3aS,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 66822570 |
| Molecular Formula | C29H35N5O4Si |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 8-[(3aS,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(c3cnn4c(N)ncnc34)[C@@H]2O1 |
| InChI | InChI=1S/C29H35N5O4Si/c1-28(2,3)39(19-12-8-6-9-13-19,20-14-10-7-11-15-20)35-17-22-24-25(38-29(4,5)37-24)23(36-22)21-16-33-34-26(21)31-18-32-27(34)30/h6-16,18,22-25H,17H2,1-5H3,(H2,30,31,32)/t22-,23?,24-,25+/m1/s1 |
| InChIKey | MUTWAGOMGCLMFN-IWUGNULFSA-N |
| XLogP | 3.24 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|