C30H36N4O4SSi — CID 66822822
[(3aS,6R,6aR)-2,2-dimethyl-4-(4-methylsulfanylpyrazolo[1,5-a][1,3,5]triazin-8-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 66822822) has the molecular formula C30H36N4O4SSi and a molecular weight of 576.80 g/mol. Its IUPAC name is [(3aS,6R,6aR)-2,2-dimethyl-4-(4-methylsulfanylpyrazolo[1,5-a][1,3,5]triazin-8-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,6R,6aR)-2,2-dimethyl-4-(4-methylsulfanylpyrazolo[1,5-a][1,3,5]triazin-8-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 66822822 |
| Molecular Formula | C30H36N4O4SSi |
| Molecular Weight | 576.80 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | [(3aS,6R,6aR)-2,2-dimethyl-4-(4-methylsulfanylpyrazolo[1,5-a][1,3,5]triazin-8-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CSc1ncnc2c(C3O[C@H](CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)[C@H]4OC(C)(C)O[C@@H]34)cnn12 |
| InChI | InChI=1S/C30H36N4O4SSi/c1-29(2,3)40(20-13-9-7-10-14-20,21-15-11-8-12-16-21)35-18-23-25-26(38-30(4,5)37-25)24(36-23)22-17-33-34-27(22)31-19-32-28(34)39-6/h7-17,19,23-26H,18H2,1-6H3/t23-,24?,25-,26+/m1/s1 |
| InChIKey | JOWBCBURRBZMTF-TZZBBBQFSA-N |
| XLogP | 4.38 |
| TPSA | 80.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.80 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|