C18H26N2O5S2 — CID 66822990
trans-(1S,2S)-4-(4-tert-butylsulfonylthieno[3,2-d]pyrimidin-7-yl)-2-(methoxymethoxymethyl)cyclopentan-1-ol (PubChem CID 66822990) has the molecular formula C18H26N2O5S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is trans-(1S,2S)-4-(4-tert-butylsulfonylthieno[3,2-d]pyrimidin-7-yl)-2-(methoxymethoxymethyl)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-4-(4-tert-butylsulfonylthieno[3,2-d]pyrimidin-7-yl)-2-(methoxymethoxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 66822990 |
| Molecular Formula | C18H26N2O5S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | trans-(1S,2S)-4-(4-tert-butylsulfonylthieno[3,2-d]pyrimidin-7-yl)-2-(methoxymethoxymethyl)cyclopentan-1-ol |
| SMILES | COCOC[C@@H]1CC(c2csc3c(S(=O)(=O)C(C)(C)C)ncnc23)C[C@@H]1O |
| InChI | InChI=1S/C18H26N2O5S2/c1-18(2,3)27(22,23)17-16-15(19-9-20-17)13(8-26-16)11-5-12(14(21)6-11)7-25-10-24-4/h8-9,11-12,14,21H,5-7,10H2,1-4H3/t11?,12-,14-/m0/s1 |
| InChIKey | SPSKNJMCEWGDFS-WGIUUAEBSA-N |
| XLogP | 2.74 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|