About 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one
2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one (PubChem CID 66823266) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one |
| PubChem CID | 66823266 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one |
| SMILES | C=C(C)C(=O)OCCN(C)C.O=C1CCCN1 |
| InChI | InChI=1S/C8H15NO2.C4H7NO/c1-7(2)8(10)11-6-5-9(3)4;6-4-2-1-3-5-4/h1,5-6H2,2-4H3;1-3H2,(H,5,6) |
| InChIKey | YMEIFRNAMMXCSO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one?
The IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one (CID 66823266) is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one?
The canonical SMILES for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one is C=C(C)C(=O)OCCN(C)C.O=C1CCCN1.
What is the InChIKey of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one?
The InChIKey is YMEIFRNAMMXCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C4H7NO/c1-7(2)8(10)11-6-5-9(3)4;6-4-2-1-3-5-4/h1,5-6H2,2-4H3;1-3H2,(H,5,6).
What are the key properties of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one?
2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one has a molecular weight of 242.32 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;pyrrolidin-2-one is sourced from PubChem (CID 66823266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).