C35H32N4O6 — CID 66823305
[4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-(phenylmethoxymethyl)cyclopentyl] 4-nitrobenzoate (PubChem CID 66823305) has the molecular formula C35H32N4O6 and a molecular weight of 604.66 g/mol. Its IUPAC name is [4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-(phenylmethoxymethyl)cyclopentyl] 4-nitrobenzoate.
| Compound Name | [4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-(phenylmethoxymethyl)cyclopentyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 66823305 |
| Molecular Formula | C35H32N4O6 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | [4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]furo[3,2-d]pyrimidin-7-yl]-2-(phenylmethoxymethyl)cyclopentyl] 4-nitrobenzoate |
| SMILES | O=C(OC1CC(c2coc3c(N[C@H]4CCc5ccccc54)ncnc23)CC1COCc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H32N4O6/c40-35(24-10-13-27(14-11-24)39(41)42)45-31-17-25(16-26(31)19-43-18-22-6-2-1-3-7-22)29-20-44-33-32(29)36-21-37-34(33)38-30-15-12-23-8-4-5-9-28(23)30/h1-11,13-14,20-21,25-26,30-31H,12,15-19H2,(H,36,37,38)/t25?,26?,30-,31?/m0/s1 |
| InChIKey | WDHJYFBRNOBACT-RUUPIVCESA-N |
| XLogP | 7.17 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|