About 8-cyclopropylquinoline
8-cyclopropylquinoline (PubChem CID 66823369) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is 8-cyclopropylquinoline.
Molecular Properties
| Compound Name | 8-cyclopropylquinoline |
| PubChem CID | 66823369 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 8-cyclopropylquinoline |
| SMILES | c1cnc2c(C3CC3)cccc2c1 |
| InChI | InChI=1S/C12H11N/c1-3-10-4-2-8-13-12(10)11(5-1)9-6-7-9/h1-5,8-9H,6-7H2 |
| InChIKey | XAJSOPHBYUJCPR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-cyclopropylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopropylquinoline?
The IUPAC name of 8-cyclopropylquinoline (CID 66823369) is 8-cyclopropylquinoline.
What is the SMILES notation for 8-cyclopropylquinoline?
The canonical SMILES for 8-cyclopropylquinoline is c1cnc2c(C3CC3)cccc2c1.
What is the InChIKey of 8-cyclopropylquinoline?
The InChIKey is XAJSOPHBYUJCPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N/c1-3-10-4-2-8-13-12(10)11(5-1)9-6-7-9/h1-5,8-9H,6-7H2.
What are the key properties of 8-cyclopropylquinoline?
8-cyclopropylquinoline has a molecular weight of 169.23 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopropylquinoline is sourced from PubChem (CID 66823369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).