About 2,3-difluoroporphyrin
2,3-difluoroporphyrin (PubChem CID 66823497) has the molecular formula C20H10F2N4
and a molecular weight of 344.32 g/mol. Its IUPAC name is 2,3-difluoroporphyrin.
Molecular Properties
| Compound Name | 2,3-difluoroporphyrin |
| PubChem CID | 66823497 |
| Molecular Formula | C20H10F2N4 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2,3-difluoroporphyrin |
| SMILES | FC1=C(F)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C20H10F2N4/c21-19-17-9-15-5-3-13(24-15)7-11-1-2-12(23-11)8-14-4-6-16(25-14)10-18(26-17)20(19)22/h1-10H/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10- |
| InChIKey | WLYBJIJGECTXFA-ITJRXXQTSA-N |
| XLogP | 4.17 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-difluoroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoroporphyrin?
The IUPAC name of 2,3-difluoroporphyrin (CID 66823497) is 2,3-difluoroporphyrin.
What is the SMILES notation for 2,3-difluoroporphyrin?
The canonical SMILES for 2,3-difluoroporphyrin is FC1=C(F)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.
What is the InChIKey of 2,3-difluoroporphyrin?
The InChIKey is WLYBJIJGECTXFA-ITJRXXQTSA-N. The full InChI is InChI=1S/C20H10F2N4/c21-19-17-9-15-5-3-13(24-15)7-11-1-2-12(23-11)8-14-4-6-16(25-14)10-18(26-17)20(19)22/h1-10H/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10-.
What are the key properties of 2,3-difluoroporphyrin?
2,3-difluoroporphyrin has a molecular weight of 344.32 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoroporphyrin is sourced from PubChem (CID 66823497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).