About 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine
4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine (PubChem CID 66823574) has the molecular formula C19H21ClN2OS
and a molecular weight of 360.91 g/mol. Its IUPAC name is 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine.
Molecular Properties
| Compound Name | 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine |
| PubChem CID | 66823574 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine |
| SMILES | CCc1ccc(C(Cl)COc2ccc(C=C3CSCN3)cc2)nc1 |
| InChI | InChI=1S/C19H21ClN2OS/c1-2-14-5-8-19(21-10-14)18(20)11-23-17-6-3-15(4-7-17)9-16-12-24-13-22-16/h3-10,18,22H,2,11-13H2,1H3 |
| InChIKey | DUMUNRSNVQYNJE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine?
The IUPAC name of 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine (CID 66823574) is 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine.
What is the SMILES notation for 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine?
The canonical SMILES for 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine is CCc1ccc(C(Cl)COc2ccc(C=C3CSCN3)cc2)nc1.
What is the InChIKey of 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine?
The InChIKey is DUMUNRSNVQYNJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2OS/c1-2-14-5-8-19(21-10-14)18(20)11-23-17-6-3-15(4-7-17)9-16-12-24-13-22-16/h3-10,18,22H,2,11-13H2,1H3.
What are the key properties of 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine?
4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine has a molecular weight of 360.91 g/mol, XLogP of 4.64, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[2-chloro-2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methylidene]-1,3-thiazolidine is sourced from PubChem (CID 66823574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).