C22H20ClF3O3 — CID 66823716
4-[5-(4-chlorophenyl)-2-(trifluoromethyl)phenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 66823716) has the molecular formula C22H20ClF3O3 and a molecular weight of 424.85 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-2-(trifluoromethyl)phenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[5-(4-chlorophenyl)-2-(trifluoromethyl)phenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 66823716 |
| Molecular Formula | C22H20ClF3O3 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-2-(trifluoromethyl)phenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CC1(C)OC(C)(C)C(=O)C(c2cc(-c3ccc(Cl)cc3)ccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C22H20ClF3O3/c1-20(2)18(27)17(19(28)21(3,4)29-20)15-11-13(7-10-16(15)22(24,25)26)12-5-8-14(23)9-6-12/h5-11,17H,1-4H3 |
| InChIKey | UDYWITGBZUBZGV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|