C18H21N3O3S — CID 66823752
4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-N,N-diethylbenzamide (PubChem CID 66823752) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-N,N-diethylbenzamide.
| Compound Name | 4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 66823752 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-9-yl)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C2=CC=CN3CCS(=O)(=O)N=C23)cc1 |
| InChI | InChI=1S/C18H21N3O3S/c1-3-20(4-2)18(22)15-9-7-14(8-10-15)16-6-5-11-21-12-13-25(23,24)19-17(16)21/h5-11H,3-4,12-13H2,1-2H3 |
| InChIKey | QEJTVLHJMVQKCY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |