About 12,13-dichloro-21,22-dihydroporphyrin
12,13-dichloro-21,22-dihydroporphyrin (PubChem CID 66823775) has the molecular formula C20H12Cl2N4
and a molecular weight of 379.25 g/mol. Its IUPAC name is 12,13-dichloro-21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | 12,13-dichloro-21,22-dihydroporphyrin |
| PubChem CID | 66823775 |
| Molecular Formula | C20H12Cl2N4 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 12,13-dichloro-21,22-dihydroporphyrin |
| SMILES | ClC1=C(Cl)c2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3 |
| InChI | InChI=1S/C20H12Cl2N4/c21-19-17-9-15-5-3-13(24-15)7-11-1-2-12(23-11)8-14-4-6-16(25-14)10-18(26-17)20(19)22/h1-10,23-24H/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10- |
| InChIKey | GHZASQBUMWMNPT-ITJRXXQTSA-N |
| XLogP | 5.79 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 12,13-dichloro-21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12,13-dichloro-21,22-dihydroporphyrin?
The IUPAC name of 12,13-dichloro-21,22-dihydroporphyrin (CID 66823775) is 12,13-dichloro-21,22-dihydroporphyrin.
What is the SMILES notation for 12,13-dichloro-21,22-dihydroporphyrin?
The canonical SMILES for 12,13-dichloro-21,22-dihydroporphyrin is ClC1=C(Cl)c2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.
What is the InChIKey of 12,13-dichloro-21,22-dihydroporphyrin?
The InChIKey is GHZASQBUMWMNPT-ITJRXXQTSA-N. The full InChI is InChI=1S/C20H12Cl2N4/c21-19-17-9-15-5-3-13(24-15)7-11-1-2-12(23-11)8-14-4-6-16(25-14)10-18(26-17)20(19)22/h1-10,23-24H/b11-7-,12-8-,13-7-,14-8-,15-9-,16-10-,17-9-,18-10-.
What are the key properties of 12,13-dichloro-21,22-dihydroporphyrin?
12,13-dichloro-21,22-dihydroporphyrin has a molecular weight of 379.25 g/mol, XLogP of 5.79, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12,13-dichloro-21,22-dihydroporphyrin is sourced from PubChem (CID 66823775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).