C13H10Cl2N2O2S — CID 66824079
9-(2,3-dichlorophenyl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide (PubChem CID 66824079) has the molecular formula C13H10Cl2N2O2S and a molecular weight of 329.21 g/mol. Its IUPAC name is 9-(2,3-dichlorophenyl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide.
| Compound Name | 9-(2,3-dichlorophenyl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide |
|---|---|
| PubChem CID | 66824079 |
| Molecular Formula | C13H10Cl2N2O2S |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 9-(2,3-dichlorophenyl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide |
| SMILES | O=S1(=O)CCN2C=CC=C(c3cccc(Cl)c3Cl)C2=N1 |
| InChI | InChI=1S/C13H10Cl2N2O2S/c14-11-5-1-3-9(12(11)15)10-4-2-6-17-7-8-20(18,19)16-13(10)17/h1-6H,7-8H2 |
| InChIKey | MCABPSUURSLSEC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |