C21H31FN6O3SSi — CID 66824287
2-[[4-[1-[1-ethylsulfonyl-3-(fluoromethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 66824287) has the molecular formula C21H31FN6O3SSi and a molecular weight of 494.67 g/mol. Its IUPAC name is 2-[[4-[1-[1-ethylsulfonyl-3-(fluoromethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[1-[1-ethylsulfonyl-3-(fluoromethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 66824287 |
| Molecular Formula | C21H31FN6O3SSi |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 2-[[4-[1-[1-ethylsulfonyl-3-(fluoromethyl)azetidin-3-yl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCS(=O)(=O)N1CC(CF)(n2cc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)cn2)C1 |
| InChI | InChI=1S/C21H31FN6O3SSi/c1-5-32(29,30)27-13-21(12-22,14-27)28-11-17(10-25-28)19-18-6-7-26(20(18)24-15-23-19)16-31-8-9-33(2,3)4/h6-7,10-11,15H,5,8-9,12-14,16H2,1-4H3 |
| InChIKey | CNUQFUUZUSCUDQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|