C9H11F3O2 — CID 66824291
trans-(1R,3S)-2,2-dimethyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 66824291) has the molecular formula C9H11F3O2 and a molecular weight of 208.18 g/mol. Its IUPAC name is trans-(1R,3S)-2,2-dimethyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,3S)-2,2-dimethyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 66824291 |
| Molecular Formula | C9H11F3O2 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | trans-(1R,3S)-2,2-dimethyl-3-[(E)-3,3,3-trifluoroprop-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)[C@@H]1/C=C/C(F)(F)F |
| InChI | InChI=1S/C9H11F3O2/c1-8(2)5(6(8)7(13)14)3-4-9(10,11)12/h3-6H,1-2H3,(H,13,14)/b4-3+/t5-,6-/m0/s1 |
| InChIKey | NEWUEEGNRXFZAP-WFYOFFIASA-N |
| XLogP | 2.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|