C31H41FN6O4 — CID 66824436
[4-[[2-[3-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]anilino]-5-fluoropyridine-3-carbonyl]amino]cyclohexyl]-tert-butylcarbamic acid (PubChem CID 66824436) has the molecular formula C31H41FN6O4 and a molecular weight of 580.71 g/mol. Its IUPAC name is [4-[[2-[3-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]anilino]-5-fluoropyridine-3-carbonyl]amino]cyclohexyl]-tert-butylcarbamic acid.
| Compound Name | [4-[[2-[3-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]anilino]-5-fluoropyridine-3-carbonyl]amino]cyclohexyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 66824436 |
| Molecular Formula | C31H41FN6O4 |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | [4-[[2-[3-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]anilino]-5-fluoropyridine-3-carbonyl]amino]cyclohexyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCC(NC(=O)c2cc(F)cnc2Nc2cccc(C(=O)N[C@H]3CN4CCC3CC4)c2)CC1 |
| InChI | InChI=1S/C31H41FN6O4/c1-31(2,3)38(30(41)42)24-9-7-22(8-10-24)35-29(40)25-16-21(32)17-33-27(25)34-23-6-4-5-20(15-23)28(39)36-26-18-37-13-11-19(26)12-14-37/h4-6,15-17,19,22,24,26H,7-14,18H2,1-3H3,(H,33,34)(H,35,40)(H,36,39)(H,41,42)/t22?,24?,26-/m0/s1 |
| InChIKey | DSYZBXHJNOLOQH-GNCHDMCWSA-N |
| XLogP | 4.61 |
| TPSA | 126.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |