About 3,4-bis(ethenyl)pyridazine
3,4-bis(ethenyl)pyridazine (PubChem CID 66824517) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 3,4-bis(ethenyl)pyridazine.
Molecular Properties
| Compound Name | 3,4-bis(ethenyl)pyridazine |
| PubChem CID | 66824517 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 3,4-bis(ethenyl)pyridazine |
| SMILES | C=Cc1ccnnc1C=C |
| InChI | InChI=1S/C8H8N2/c1-3-7-5-6-9-10-8(7)4-2/h3-6H,1-2H2 |
| InChIKey | UEOWGNIFSGBHIY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-bis(ethenyl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(ethenyl)pyridazine?
The IUPAC name of 3,4-bis(ethenyl)pyridazine (CID 66824517) is 3,4-bis(ethenyl)pyridazine.
What is the SMILES notation for 3,4-bis(ethenyl)pyridazine?
The canonical SMILES for 3,4-bis(ethenyl)pyridazine is C=Cc1ccnnc1C=C.
What is the InChIKey of 3,4-bis(ethenyl)pyridazine?
The InChIKey is UEOWGNIFSGBHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-3-7-5-6-9-10-8(7)4-2/h3-6H,1-2H2.
What are the key properties of 3,4-bis(ethenyl)pyridazine?
3,4-bis(ethenyl)pyridazine has a molecular weight of 132.17 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(ethenyl)pyridazine is sourced from PubChem (CID 66824517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).