C9H16O2 — CID 66825054
1-[(2R,4S)-4-methyloxan-2-yl]propan-2-one (PubChem CID 66825054) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 1-[(2R,4S)-4-methyloxan-2-yl]propan-2-one.
| Compound Name | 1-[(2R,4S)-4-methyloxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 66825054 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 1-[(2R,4S)-4-methyloxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1C[C@@H](C)CCO1 |
| InChI | InChI=1S/C9H16O2/c1-7-3-4-11-9(5-7)6-8(2)10/h7,9H,3-6H2,1-2H3/t7-,9+/m0/s1 |
| InChIKey | LBOQZBRHNXPXIY-IONNQARKSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |