C12H14O3 — CID 66825100
2,3,4,4a,5a,6-hexahydropyrano[3,2-b]chromen-10-ol (PubChem CID 66825100) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2,3,4,4a,5a,6-hexahydropyrano[3,2-b]chromen-10-ol.
| Compound Name | 2,3,4,4a,5a,6-hexahydropyrano[3,2-b]chromen-10-ol |
|---|---|
| PubChem CID | 66825100 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2,3,4,4a,5a,6-hexahydropyrano[3,2-b]chromen-10-ol |
| SMILES | OC1=C2OCCCC2OC2CC=CC=C12 |
| InChI | InChI=1S/C12H14O3/c13-11-8-4-1-2-5-9(8)15-10-6-3-7-14-12(10)11/h1-2,4,9-10,13H,3,5-7H2 |
| InChIKey | RNJYBZFANGDXCH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |