About 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid
4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid (PubChem CID 66825256) has the molecular formula C23H17Cl2N3O4
and a molecular weight of 470.31 g/mol. Its IUPAC name is 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid.
Molecular Properties
| Compound Name | 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid |
| PubChem CID | 66825256 |
| Molecular Formula | C23H17Cl2N3O4 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid |
| SMILES | O=C(O)C(CCn1nnc2cccc(Cl)c2c1=O)Oc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O4/c24-16-8-4-14(5-9-16)15-6-10-17(11-7-15)32-20(23(30)31)12-13-28-22(29)21-18(25)2-1-3-19(21)26-27-28/h1-11,20H,12-13H2,(H,30,31) |
| InChIKey | NQEHMXDRADRYHF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid?
The IUPAC name of 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid (CID 66825256) is 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid.
What is the SMILES notation for 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid?
The canonical SMILES for 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid is O=C(O)C(CCn1nnc2cccc(Cl)c2c1=O)Oc1ccc(-c2ccc(Cl)cc2)cc1.
What is the InChIKey of 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid?
The InChIKey is NQEHMXDRADRYHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17Cl2N3O4/c24-16-8-4-14(5-9-16)15-6-10-17(11-7-15)32-20(23(30)31)12-13-28-22(29)21-18(25)2-1-3-19(21)26-27-28/h1-11,20H,12-13H2,(H,30,31).
What are the key properties of 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid?
4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid has a molecular weight of 470.31 g/mol, XLogP of 4.69, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-4-oxo-1,2,3-benzotriazin-3-yl)-2-[4-(4-chlorophenyl)phenoxy]butanoic acid is sourced from PubChem (CID 66825256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).