C19H28BFO4 — CID 66825594
2-[4-fluoro-2-[2-(oxan-2-yloxy)ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 66825594) has the molecular formula C19H28BFO4 and a molecular weight of 350.24 g/mol. Its IUPAC name is 2-[4-fluoro-2-[2-(oxan-2-yloxy)ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-fluoro-2-[2-(oxan-2-yloxy)ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 66825594 |
| Molecular Formula | C19H28BFO4 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-[4-fluoro-2-[2-(oxan-2-yloxy)ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(F)cc2CCOC2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C19H28BFO4/c1-18(2)19(3,4)25-20(24-18)16-9-8-15(21)13-14(16)10-12-23-17-7-5-6-11-22-17/h8-9,13,17H,5-7,10-12H2,1-4H3 |
| InChIKey | YBZFTRVDYHAYTN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|