C15H18N2O2 — CID 66826019
spiro[1,2,3,4,4a,8a,9a,10a-octahydroxanthene-9,4'-1H-imidazole]-5'-one (PubChem CID 66826019) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is spiro[1,2,3,4,4a,8a,9a,10a-octahydroxanthene-9,4'-1H-imidazole]-5'-one.
| Compound Name | spiro[1,2,3,4,4a,8a,9a,10a-octahydroxanthene-9,4'-1H-imidazole]-5'-one |
|---|---|
| PubChem CID | 66826019 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | spiro[1,2,3,4,4a,8a,9a,10a-octahydroxanthene-9,4'-1H-imidazole]-5'-one |
| SMILES | O=C1NC=NC12C1C=CC=CC1OC1CCCCC12 |
| InChI | InChI=1S/C15H18N2O2/c18-14-15(17-9-16-14)10-5-1-3-7-12(10)19-13-8-4-2-6-11(13)15/h1,3,5,7,9-13H,2,4,6,8H2,(H,16,17,18) |
| InChIKey | RJPPLZNYJLUZOU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |