C24H25F4N5O3 — CID 66826225
1-[2-benzyl-4-[3,4-bis(difluoromethoxy)phenyl]piperazin-1-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone (PubChem CID 66826225) has the molecular formula C24H25F4N5O3 and a molecular weight of 507.49 g/mol. Its IUPAC name is 1-[2-benzyl-4-[3,4-bis(difluoromethoxy)phenyl]piperazin-1-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone.
| Compound Name | 1-[2-benzyl-4-[3,4-bis(difluoromethoxy)phenyl]piperazin-1-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone |
|---|---|
| PubChem CID | 66826225 |
| Molecular Formula | C24H25F4N5O3 |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 1-[2-benzyl-4-[3,4-bis(difluoromethoxy)phenyl]piperazin-1-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone |
| SMILES | Cc1nc(CC(=O)N2CCN(c3ccc(OC(F)F)c(OC(F)F)c3)CC2Cc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C24H25F4N5O3/c1-15-29-21(31-30-15)13-22(34)33-10-9-32(14-18(33)11-16-5-3-2-4-6-16)17-7-8-19(35-23(25)26)20(12-17)36-24(27)28/h2-8,12,18,23-24H,9-11,13-14H2,1H3,(H,29,30,31) |
| InChIKey | ZHSNKAZUBHLFIL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|