C30H31N7O2 — CID 66826468
4-[[3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-hydroxycyclobutyl]methylamino]butanamide (PubChem CID 66826468) has the molecular formula C30H31N7O2 and a molecular weight of 521.63 g/mol. Its IUPAC name is 4-[[3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-hydroxycyclobutyl]methylamino]butanamide.
| Compound Name | 4-[[3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-hydroxycyclobutyl]methylamino]butanamide |
|---|---|
| PubChem CID | 66826468 |
| Molecular Formula | C30H31N7O2 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 4-[[3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-hydroxycyclobutyl]methylamino]butanamide |
| SMILES | NC(=O)CCCNCC1(O)CC(c2nc(-c3ccc4ccc(-c5ccccc5)nc4c3)c3c(N)nccn23)C1 |
| InChI | InChI=1S/C30H31N7O2/c31-25(38)7-4-12-33-18-30(39)16-22(17-30)29-36-26(27-28(32)34-13-14-37(27)29)21-9-8-20-10-11-23(35-24(20)15-21)19-5-2-1-3-6-19/h1-3,5-6,8-11,13-15,22,33,39H,4,7,12,16-18H2,(H2,31,38)(H2,32,34) |
| InChIKey | FKPVHOQMPYCJBA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|