About 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine
3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine (PubChem CID 66826674) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine |
| PubChem CID | 66826674 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine |
| SMILES | c1cc2n[nH]c(C3CC3)c2c(OC2CCOCC2)n1 |
| InChI | InChI=1S/C14H17N3O2/c1-2-9(1)13-12-11(16-17-13)3-6-15-14(12)19-10-4-7-18-8-5-10/h3,6,9-10H,1-2,4-5,7-8H2,(H,16,17) |
| InChIKey | WSKARHFRNLFQNI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine?
The IUPAC name of 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine (CID 66826674) is 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine?
The canonical SMILES for 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine is c1cc2n[nH]c(C3CC3)c2c(OC2CCOCC2)n1.
What is the InChIKey of 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine?
The InChIKey is WSKARHFRNLFQNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-2-9(1)13-12-11(16-17-13)3-6-15-14(12)19-10-4-7-18-8-5-10/h3,6,9-10H,1-2,4-5,7-8H2,(H,16,17).
What are the key properties of 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine?
3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine has a molecular weight of 259.31 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-4-(oxan-4-yloxy)-2H-pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 66826674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).