C23H21F2N3O — CID 66827071
3-[(3-butoxy-2,6-difluorophenyl)methyl]-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 66827071) has the molecular formula C23H21F2N3O and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-[(3-butoxy-2,6-difluorophenyl)methyl]-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[(3-butoxy-2,6-difluorophenyl)methyl]-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 66827071 |
| Molecular Formula | C23H21F2N3O |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-[(3-butoxy-2,6-difluorophenyl)methyl]-5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCCCOc1ccc(F)c(Cc2c[nH]c3ncc(-c4cccnc4)cc23)c1F |
| InChI | InChI=1S/C23H21F2N3O/c1-2-3-9-29-21-7-6-20(24)19(22(21)25)11-17-14-28-23-18(17)10-16(13-27-23)15-5-4-8-26-12-15/h4-8,10,12-14H,2-3,9,11H2,1H3,(H,27,28) |
| InChIKey | CJEDXGCRDGXFDK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|