C30H31IN2 — CID 66827176
7-iodo-3-[2,4,6-tri(propan-2-yl)phenyl]imidazo[1,2-f]phenanthridine (PubChem CID 66827176) has the molecular formula C30H31IN2 and a molecular weight of 546.50 g/mol. Its IUPAC name is 7-iodo-3-[2,4,6-tri(propan-2-yl)phenyl]imidazo[1,2-f]phenanthridine.
| Compound Name | 7-iodo-3-[2,4,6-tri(propan-2-yl)phenyl]imidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 66827176 |
| Molecular Formula | C30H31IN2 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 7-iodo-3-[2,4,6-tri(propan-2-yl)phenyl]imidazo[1,2-f]phenanthridine |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cnc3c4ccccc4c4cc(I)ccc4n23)c(C(C)C)c1 |
| InChI | InChI=1S/C30H31IN2/c1-17(2)20-13-24(18(3)4)29(25(14-20)19(5)6)28-16-32-30-23-10-8-7-9-22(23)26-15-21(31)11-12-27(26)33(28)30/h7-19H,1-6H3 |
| InChIKey | DKBTTWNYCZKZKR-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|