About 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole
6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole (PubChem CID 66827228) has the molecular formula C15H11ClN2
and a molecular weight of 254.72 g/mol. Its IUPAC name is 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole.
Molecular Properties
| Compound Name | 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole |
| PubChem CID | 66827228 |
| Molecular Formula | C15H11ClN2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole |
| SMILES | Cc1cc(Cl)c2c(c1)[nH]c1c2ccc2cc[nH]c21 |
| InChI | InChI=1S/C15H11ClN2/c1-8-6-11(16)13-10-3-2-9-4-5-17-14(9)15(10)18-12(13)7-8/h2-7,17-18H,1H3 |
| InChIKey | VOXDNDXNOKFCBV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole?
The IUPAC name of 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole (CID 66827228) is 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole.
What is the SMILES notation for 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole?
The canonical SMILES for 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole is Cc1cc(Cl)c2c(c1)[nH]c1c2ccc2cc[nH]c21.
What is the InChIKey of 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole?
The InChIKey is VOXDNDXNOKFCBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN2/c1-8-6-11(16)13-10-3-2-9-4-5-17-14(9)15(10)18-12(13)7-8/h2-7,17-18H,1H3.
What are the key properties of 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole?
6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole has a molecular weight of 254.72 g/mol, XLogP of 4.76, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8-methyl-1,10-dihydropyrrolo[2,3-a]carbazole is sourced from PubChem (CID 66827228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).